1,3,5-Tri- O -acetyl-2-deoxy- α-D-erythro–
1,3,5-Tri-O-acetyl-2-deoxy-alpha-D-erythro-pentofuranose
CAS: 96291-74-6
Molecular Formula: C11H16O7
1,3,5-Tri- O -acetyl-2-deoxy- α-D-erythro– - Names and Identifiers
| Name | 1,3,5-Tri-O-acetyl-2-deoxy-alpha-D-erythro-pentofuranose |
| Synonyms | A-D-ERYTHRO-PENTOFURANOSE 1,3,5-tri-O-acetyl-2-deoxyribose 1,3,5-Tri- O -acetyl-2-deoxy- α-D-erythro– 1,3,5-Tri-O-acetyl-2-deoxy-a-D-ribofuranose 1,3,5-tri-O-acetyl-α,β-D-2-deoxyribofuranoside 1,3,5-Ti-O-acetyl-2-deoxy-a-D-erythro-pentofuranose 1,3,5-Tri-O-acetyl-2-deoxy-á-D-erythro-pentofuranose 1,3,5-Tri-O-acetyl-2-deoxy-alpha-D-erythro-pentofuranose 1,3,5-TRI-O-ACETYL-2-DEOXY-ALPHA-D-ERYTHRO-PENTOFURANOSE |
| CAS | 96291-74-6 |
| InChI | InChI=1/C11H16O7/c1-6(12)15-5-10-9(16-7(2)13)4-11(18-10)17-8(3)14/h9-11H,4-5H2,1-3H3/t9-,10+,11-/m0/s1 |
1,3,5-Tri- O -acetyl-2-deoxy- α-D-erythro– - Physico-chemical Properties
| Molecular Formula | C11H16O7 |
| Molar Mass | 260.24 |
| Refractive Index | 1.466 |
1,3,5-Tri- O -acetyl-2-deoxy- α-D-erythro– - Introduction
1,3, is an organic compound, commonly abbreviated as TIP. It is a sugar derivative with the following properties:
1. Appearance: TIP is a colorless or white crystalline solid.
2. solubility: TIP can be dissolved in some organic solvents, such as ethanol, dimethyl sulfoxide and chloroform, but the solubility in water is poor.
3. Melting point: The melting point of TIP is about 173-176°C.
4. chemical properties: TIP is an important sugar protecting group. It protects the alcohol hydroxyl group of the sugar and prevents the participation of the alcohol hydroxyl group in the chemical reaction. It is commonly used in the synthesis of carbohydrate compounds and glycoproteins and peptides.
The method for preparing TIP can be obtained by the acid-catalyzed demethylation reaction of 1,3, 5-trimethyl-2-deoxy-D-erythro pentofuranose (1,3, fo). Specifically, 1,3, I can be reacted with a reagent such as acetic anhydride to give 1,3, I.
Regarding safety information, TIP is generally relatively safe under standard operating conditions, but the following matters still need to be paid attention:
1. Avoid inhalation and contact: Avoid prolonged exposure to TIP dust or solution to avoid irritation to the respiratory tract and skin.
2. Proper handling and storage: When using or storing TIP, pay attention to moisture-proof, moisture-proof, and light-proof to prevent its decomposition.
3. Use personal protective equipment: Wear appropriate personal protective equipment such as protective gloves, goggles and protective clothing when operating TIP to avoid skin contact and eye irritation.
In summary, 1,3, is an important carbohydrate protecting group, commonly used in the synthesis and protection of carbohydrate compounds. However, when using and handling, it is still necessary to pay attention to safe operation to ensure personal safety and the smooth progress of the experiment.
1. Appearance: TIP is a colorless or white crystalline solid.
2. solubility: TIP can be dissolved in some organic solvents, such as ethanol, dimethyl sulfoxide and chloroform, but the solubility in water is poor.
3. Melting point: The melting point of TIP is about 173-176°C.
4. chemical properties: TIP is an important sugar protecting group. It protects the alcohol hydroxyl group of the sugar and prevents the participation of the alcohol hydroxyl group in the chemical reaction. It is commonly used in the synthesis of carbohydrate compounds and glycoproteins and peptides.
The method for preparing TIP can be obtained by the acid-catalyzed demethylation reaction of 1,3, 5-trimethyl-2-deoxy-D-erythro pentofuranose (1,3, fo). Specifically, 1,3, I can be reacted with a reagent such as acetic anhydride to give 1,3, I.
Regarding safety information, TIP is generally relatively safe under standard operating conditions, but the following matters still need to be paid attention:
1. Avoid inhalation and contact: Avoid prolonged exposure to TIP dust or solution to avoid irritation to the respiratory tract and skin.
2. Proper handling and storage: When using or storing TIP, pay attention to moisture-proof, moisture-proof, and light-proof to prevent its decomposition.
3. Use personal protective equipment: Wear appropriate personal protective equipment such as protective gloves, goggles and protective clothing when operating TIP to avoid skin contact and eye irritation.
In summary, 1,3, is an important carbohydrate protecting group, commonly used in the synthesis and protection of carbohydrate compounds. However, when using and handling, it is still necessary to pay attention to safe operation to ensure personal safety and the smooth progress of the experiment.
Last Update：2024-04-09 21:21:28
